C20H22BrN5O5S — CID 4007814
2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[1-(4-nitrophenyl)ethylideneamino]acetamide (PubChem CID 4007814) has the molecular formula C20H22BrN5O5S and a molecular weight of 524.40 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[1-(4-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[1-(4-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 4007814 |
| Molecular Formula | C20H22BrN5O5S |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[1-(4-nitrophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CN1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22BrN5O5S/c1-15(16-2-6-18(7-3-16)26(28)29)22-23-20(27)14-24-10-12-25(13-11-24)32(30,31)19-8-4-17(21)5-9-19/h2-9H,10-14H2,1H3,(H,23,27) |
| InChIKey | JYKVEVNQTMTMHM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|