C17H16BrN3O3S — CID 92652489
N-[(Z)-1-(4-bromophenyl)ethylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 92652489) has the molecular formula C17H16BrN3O3S and a molecular weight of 422.30 g/mol. Its IUPAC name is N-[(Z)-1-(4-bromophenyl)ethylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-1-(4-bromophenyl)ethylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 92652489 |
| Molecular Formula | C17H16BrN3O3S |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | N-[(Z)-1-(4-bromophenyl)ethylideneamino]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | C/C(=N/NC(=O)CSCc1ccc([N+](=O)[O-])cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrN3O3S/c1-12(14-4-6-15(18)7-5-14)19-20-17(22)11-25-10-13-2-8-16(9-3-13)21(23)24/h2-9H,10-11H2,1H3,(H,20,22)/b19-12- |
| InChIKey | NUZPRYZXYRIIKF-UNOMPAQXSA-N |
| XLogP | 4.13 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|