C10H10BrN3O3 — CID 51342256
N-[(E)-1-(4-bromophenyl)ethylideneamino]-2-nitroacetamide (PubChem CID 51342256) has the molecular formula C10H10BrN3O3 and a molecular weight of 300.11 g/mol. Its IUPAC name is N-[(E)-1-(4-bromophenyl)ethylideneamino]-2-nitroacetamide.
| Compound Name | N-[(E)-1-(4-bromophenyl)ethylideneamino]-2-nitroacetamide |
|---|---|
| PubChem CID | 51342256 |
| Molecular Formula | C10H10BrN3O3 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | N-[(E)-1-(4-bromophenyl)ethylideneamino]-2-nitroacetamide |
| SMILES | C/C(=N\NC(=O)C[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H10BrN3O3/c1-7(8-2-4-9(11)5-3-8)12-13-10(15)6-14(16)17/h2-5H,6H2,1H3,(H,13,15)/b12-7+ |
| InChIKey | XOGAFSSCMAQDCJ-KPKJPENVSA-N |
| XLogP | 1.57 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|