C21H24Cl2N4O3S — CID 1417002
N-[1-(2,4-dichlorophenyl)ethylideneamino]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 1417002) has the molecular formula C21H24Cl2N4O3S and a molecular weight of 483.42 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethylideneamino]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethylideneamino]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 1417002 |
| Molecular Formula | C21H24Cl2N4O3S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethylideneamino]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | CC(=NNC(=O)CN1CCN(S(=O)(=O)c2ccc(C)cc2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N4O3S/c1-15-3-6-18(7-4-15)31(29,30)27-11-9-26(10-12-27)14-21(28)25-24-16(2)19-8-5-17(22)13-20(19)23/h3-8,13H,9-12,14H2,1-2H3,(H,25,28) |
| InChIKey | WHSLNJCOKGNBDN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|