C20H22Cl2N4O3S — CID 6865338
N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 6865338) has the molecular formula C20H22Cl2N4O3S and a molecular weight of 469.39 g/mol. Its IUPAC name is N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 6865338 |
| Molecular Formula | C20H22Cl2N4O3S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-[(E)-(3,4-dichlorophenyl)methylideneamino]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(=O)N/N=C/c3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H22Cl2N4O3S/c1-15-2-5-17(6-3-15)30(28,29)26-10-8-25(9-11-26)14-20(27)24-23-13-16-4-7-18(21)19(22)12-16/h2-7,12-13H,8-11,14H2,1H3,(H,24,27)/b23-13+ |
| InChIKey | FBIQMBIDTDJHKI-YDZHTSKRSA-N |
| XLogP | 2.76 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|