C23H30N4O6S — CID 3643397
2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 3643397) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3643397 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(C=NNC(=O)CN2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C23H30N4O6S/c1-17-5-8-19(9-6-17)34(29,30)27-13-11-26(12-14-27)16-21(28)25-24-15-18-7-10-20(31-2)23(33-4)22(18)32-3/h5-10,15H,11-14,16H2,1-4H3,(H,25,28) |
| InChIKey | UBKKWPWTTNEXKH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|