C20H21Cl3N4O — CID 1383029
2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(3,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 1383029) has the molecular formula C20H21Cl3N4O and a molecular weight of 439.77 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(3,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(3,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1383029 |
| Molecular Formula | C20H21Cl3N4O |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-[(3,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(Cl)cc2)CC1)NN=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl3N4O/c21-17-4-1-15(2-5-17)13-26-7-9-27(10-8-26)14-20(28)25-24-12-16-3-6-18(22)19(23)11-16/h1-6,11-12H,7-10,13-14H2,(H,25,28) |
| InChIKey | UBXXMIUAJQBQHE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|