C15H11Cl3N2O — CID 93224601
2-(4-chlorophenyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 93224601) has the molecular formula C15H11Cl3N2O and a molecular weight of 341.63 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 93224601 |
| Molecular Formula | C15H11Cl3N2O |
| Molecular Weight | 341.63 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)N/N=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3N2O/c16-12-4-1-10(2-5-12)8-15(21)20-19-9-11-3-6-13(17)14(18)7-11/h1-7,9H,8H2,(H,20,21)/b19-9- |
| InChIKey | PFZKFBSOGUNLDQ-OCKHKDLRSA-N |
| XLogP | 4.34 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|