C12H16Cl2N3O+ — CID 5474227
[2-[(2Z)-2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium (PubChem CID 5474227) has the molecular formula C12H16Cl2N3O+ and a molecular weight of 289.19 g/mol. Its IUPAC name is [2-[(2Z)-2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[(2Z)-2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 5474227 |
| Molecular Formula | C12H16Cl2N3O+ |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [2-[(2Z)-2-[(3,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(=O)N/N=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O/c1-17(2,3)8-12(18)16-15-7-9-4-5-10(13)11(14)6-9/h4-7H,8H2,1-3H3/p+1/b15-7- |
| InChIKey | BZXRNTVNPSZQTQ-CHHVJCJISA-O |
| XLogP | 2.15 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|