C15H14Cl2N4OS — CID 5437380
N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 5437380) has the molecular formula C15H14Cl2N4OS and a molecular weight of 369.28 g/mol. Its IUPAC name is N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 5437380 |
| Molecular Formula | C15H14Cl2N4OS |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)N/N=C\c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H14Cl2N4OS/c1-9-5-10(2)20-15(19-9)23-8-14(22)21-18-7-11-3-4-12(16)13(17)6-11/h3-7H,8H2,1-2H3,(H,21,22)/b18-7- |
| InChIKey | URTKRNYKGMCIRH-WSVATBPTSA-N |
| XLogP | 3.64 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|