C22H19Br2ClN4O2S — CID 126245372
N-[(Z)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 126245372) has the molecular formula C22H19Br2ClN4O2S and a molecular weight of 598.75 g/mol. Its IUPAC name is N-[(Z)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126245372 |
| Molecular Formula | C22H19Br2ClN4O2S |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 595.93 |
| IUPAC Name | N-[(Z)-[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)N/N=C\c2cc(Br)c(OCc3ccccc3Cl)c(Br)c2)n1 |
| InChI | InChI=1S/C22H19Br2ClN4O2S/c1-13-7-14(2)28-22(27-13)32-12-20(30)29-26-10-15-8-17(23)21(18(24)9-15)31-11-16-5-3-4-6-19(16)25/h3-10H,11-12H2,1-2H3,(H,29,30)/b26-10- |
| InChIKey | CIRKNVUIFLJRCE-KALUYTGESA-N |
| XLogP | 6.09 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|