C28H27IN4O3S — CID 126238865
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide (PubChem CID 126238865) has the molecular formula C28H27IN4O3S and a molecular weight of 626.52 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126238865 |
| Molecular Formula | C28H27IN4O3S |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 626.08 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CSc2nc(C)cc(C)n2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H27IN4O3S/c1-4-35-25-14-20(15-30-33-26(34)17-37-28-31-18(2)12-19(3)32-28)13-24(29)27(25)36-16-22-10-7-9-21-8-5-6-11-23(21)22/h5-15H,4,16-17H2,1-3H3,(H,33,34)/b30-15- |
| InChIKey | BDONVOOUUDEBQK-MNDYBZJGSA-N |
| XLogP | 6.07 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|