C25H21IN2O3S — CID 124533302
N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]thiophene-2-carboxamide (PubChem CID 124533302) has the molecular formula C25H21IN2O3S and a molecular weight of 556.43 g/mol. Its IUPAC name is N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 124533302 |
| Molecular Formula | C25H21IN2O3S |
| Molecular Weight | 556.43 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | N-[(Z)-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]thiophene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cccs2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C25H21IN2O3S/c1-2-30-22-14-17(15-27-28-25(29)23-11-6-12-32-23)13-21(26)24(22)31-16-19-9-5-8-18-7-3-4-10-20(18)19/h3-15H,2,16H2,1H3,(H,28,29)/b27-15- |
| InChIKey | XMRCFGFCFAAYGK-DICXZTSXSA-N |
| XLogP | 6.25 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|