C24H19IN2O3S — CID 124533288
N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]thiophene-2-carboxamide (PubChem CID 124533288) has the molecular formula C24H19IN2O3S and a molecular weight of 542.40 g/mol. Its IUPAC name is N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 124533288 |
| Molecular Formula | C24H19IN2O3S |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]thiophene-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cccs2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H19IN2O3S/c1-29-21-13-16(14-26-27-24(28)22-10-5-11-31-22)12-20(25)23(21)30-15-18-8-4-7-17-6-2-3-9-19(17)18/h2-14H,15H2,1H3,(H,27,28)/b26-14- |
| InChIKey | UBLUCDWMRLKFAR-WGARJPEWSA-N |
| XLogP | 5.86 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|