C16H17IN2O3S — CID 21380084
N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 21380084) has the molecular formula C16H17IN2O3S and a molecular weight of 444.29 g/mol. Its IUPAC name is N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 21380084 |
| Molecular Formula | C16H17IN2O3S |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cccs2)cc(I)c1OCC |
| InChI | InChI=1S/C16H17IN2O3S/c1-3-21-13-9-11(8-12(17)15(13)22-4-2)10-18-19-16(20)14-6-5-7-23-14/h5-10H,3-4H2,1-2H3,(H,19,20)/b18-10+ |
| InChIKey | GRCMLGZIWNUUHZ-VCHYOVAHSA-N |
| XLogP | 3.91 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|