C27H24IN3O3 — CID 126046703
N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126046703) has the molecular formula C27H24IN3O3 and a molecular weight of 565.41 g/mol. Its IUPAC name is N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126046703 |
| Molecular Formula | C27H24IN3O3 |
| Molecular Weight | 565.41 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc(I)c1OCC |
| InChI | InChI=1S/C27H24IN3O3/c1-3-33-25-15-18(14-22(28)26(25)34-4-2)17-29-31-27(32)21-16-24(19-10-6-5-7-11-19)30-23-13-9-8-12-20(21)23/h5-17H,3-4H2,1-2H3,(H,31,32)/b29-17- |
| InChIKey | SUOJLLIGHUBKNZ-RHANQZHGSA-N |
| XLogP | 6.07 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.41 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|