C36H29N3O3 — CID 126036355
N-[(E)-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126036355) has the molecular formula C36H29N3O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126036355 |
| Molecular Formula | C36H29N3O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)ccc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H29N3O3/c1-2-41-35-21-25(17-19-34(35)42-24-26-16-18-27-10-6-7-13-29(27)20-26)23-37-39-36(40)31-22-33(28-11-4-3-5-12-28)38-32-15-9-8-14-30(31)32/h3-23H,2,24H2,1H3,(H,39,40)/b37-23+ |
| InChIKey | DCCKJVSIUNTVDI-GUBAARJWSA-N |
| XLogP | 7.80 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|