C33H26IN3O2 — CID 126054166
N-[(E)-[4-[(4-iodophenyl)methoxy]-3-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126054166) has the molecular formula C33H26IN3O2 and a molecular weight of 623.49 g/mol. Its IUPAC name is N-[(E)-[4-[(4-iodophenyl)methoxy]-3-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[4-[(4-iodophenyl)methoxy]-3-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126054166 |
| Molecular Formula | C33H26IN3O2 |
| Molecular Weight | 623.49 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | N-[(E)-[4-[(4-iodophenyl)methoxy]-3-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)ccc1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C33H26IN3O2/c1-2-8-26-19-24(15-18-32(26)39-22-23-13-16-27(34)17-14-23)21-35-37-33(38)29-20-31(25-9-4-3-5-10-25)36-30-12-7-6-11-28(29)30/h2-7,9-21H,1,8,22H2,(H,37,38)/b35-21+ |
| InChIKey | MYYZJJBGIHUEPQ-XICOUIIWSA-N |
| XLogP | 7.58 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.49 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|