C31H23N3O4 — CID 126053329
N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126053329) has the molecular formula C31H23N3O4 and a molecular weight of 501.54 g/mol. Its IUPAC name is N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126053329 |
| Molecular Formula | C31H23N3O4 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | N-[(E)-[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(OCc2ccc3c(c2)OCO3)cc1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C31H23N3O4/c35-31(26-17-28(23-6-2-1-3-7-23)33-27-9-5-4-8-25(26)27)34-32-18-21-10-13-24(14-11-21)36-19-22-12-15-29-30(16-22)38-20-37-29/h1-18H,19-20H2,(H,34,35)/b32-18+ |
| InChIKey | SHMNUMFDDRMBQI-KCSSXMTESA-N |
| XLogP | 5.97 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|