C30H21Cl2N3O2 — CID 6008188
N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 6008188) has the molecular formula C30H21Cl2N3O2 and a molecular weight of 526.42 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 6008188 |
| Molecular Formula | C30H21Cl2N3O2 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc(Cl)cc2Cl)cc1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C30H21Cl2N3O2/c31-23-13-12-22(27(32)16-23)19-37-24-14-10-20(11-15-24)18-33-35-30(36)26-17-29(21-6-2-1-3-7-21)34-28-9-5-4-8-25(26)28/h1-18H,19H2,(H,35,36)/b33-18- |
| InChIKey | HDUZUBSFFJVPCK-OHUYPAJKSA-N |
| XLogP | 7.55 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|