C23H15Cl2N3O — CID 6018780
2-(4-chlorophenyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]quinoline-4-carboxamide (PubChem CID 6018780) has the molecular formula C23H15Cl2N3O and a molecular weight of 420.30 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6018780 |
| Molecular Formula | C23H15Cl2N3O |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(Z)-(4-chlorophenyl)methylideneamino]quinoline-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H15Cl2N3O/c24-17-9-5-15(6-10-17)14-26-28-23(29)20-13-22(16-7-11-18(25)12-8-16)27-21-4-2-1-3-19(20)21/h1-14H,(H,28,29)/b26-14- |
| InChIKey | FIYIMUFNOHCLRQ-WGARJPEWSA-N |
| XLogP | 5.97 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|