C23H14ClI2N3O2 — CID 136658791
2-(4-chlorophenyl)-N-[(4-hydroxy-3,5-diiodophenyl)methylideneamino]quinoline-4-carboxamide (PubChem CID 136658791) has the molecular formula C23H14ClI2N3O2 and a molecular weight of 653.65 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(4-hydroxy-3,5-diiodophenyl)methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(4-hydroxy-3,5-diiodophenyl)methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 136658791 |
| Molecular Formula | C23H14ClI2N3O2 |
| Molecular Weight | 653.65 g/mol |
| Exact Mass | 652.89 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(4-hydroxy-3,5-diiodophenyl)methylideneamino]quinoline-4-carboxamide |
| SMILES | O=C(NN=Cc1cc(I)c(O)c(I)c1)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H14ClI2N3O2/c24-15-7-5-14(6-8-15)21-11-17(16-3-1-2-4-20(16)28-21)23(31)29-27-12-13-9-18(25)22(30)19(26)10-13/h1-12,30H,(H,29,31) |
| InChIKey | MPLWQYWVGPFUCW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|