C23H16ClN3O — CID 6884313
N-[(E)-(3-chlorophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 6884313) has the molecular formula C23H16ClN3O and a molecular weight of 385.85 g/mol. Its IUPAC name is N-[(E)-(3-chlorophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 6884313 |
| Molecular Formula | C23H16ClN3O |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(Cl)c1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C23H16ClN3O/c24-18-10-6-7-16(13-18)15-25-27-23(28)20-14-22(17-8-2-1-3-9-17)26-21-12-5-4-11-19(20)21/h1-15H,(H,27,28)/b25-15+ |
| InChIKey | FKDVBRSUKGIESW-MFKUBSTISA-N |
| XLogP | 5.32 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|