C35H25N3O2 — CID 2348277
N-[(3-phenoxyphenyl)methylideneamino]-2-(4-phenylphenyl)quinoline-4-carboxamide (PubChem CID 2348277) has the molecular formula C35H25N3O2 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-[(3-phenoxyphenyl)methylideneamino]-2-(4-phenylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(3-phenoxyphenyl)methylideneamino]-2-(4-phenylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2348277 |
| Molecular Formula | C35H25N3O2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | N-[(3-phenoxyphenyl)methylideneamino]-2-(4-phenylphenyl)quinoline-4-carboxamide |
| SMILES | O=C(NN=Cc1cccc(Oc2ccccc2)c1)c1cc(-c2ccc(-c3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C35H25N3O2/c39-35(38-36-24-25-10-9-15-30(22-25)40-29-13-5-2-6-14-29)32-23-34(37-33-17-8-7-16-31(32)33)28-20-18-27(19-21-28)26-11-3-1-4-12-26/h1-24H,(H,38,39) |
| InChIKey | GKULCLQHEHBUMS-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|