C25H19N3O3 — CID 126040448
N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126040448) has the molecular formula C25H19N3O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126040448 |
| Molecular Formula | C25H19N3O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc2c(c1)OCCO2)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C25H19N3O3/c29-25(28-26-16-17-10-11-23-24(14-17)31-13-12-30-23)20-15-22(18-6-2-1-3-7-18)27-21-9-5-4-8-19(20)21/h1-11,14-16H,12-13H2,(H,28,29)/b26-16- |
| InChIKey | GVDLONFCHXQGSN-QQXSKIMKSA-N |
| XLogP | 4.44 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|