C26H18N4O — CID 9078505
N-[(Z)-naphthalen-2-ylmethylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 9078505) has the molecular formula C26H18N4O and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[(Z)-naphthalen-2-ylmethylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-naphthalen-2-ylmethylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 9078505 |
| Molecular Formula | C26H18N4O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[(Z)-naphthalen-2-ylmethylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc2ccccc2c1)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C26H18N4O/c31-26(30-28-16-18-11-12-19-6-1-2-7-20(19)14-18)23-15-25(21-8-5-13-27-17-21)29-24-10-4-3-9-22(23)24/h1-17H,(H,30,31)/b28-16- |
| InChIKey | IVCIZKYQZQYBTQ-NTFVMDSBSA-N |
| XLogP | 5.21 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|