C23H16F2N4O2 — CID 3477696
N-[[4-(difluoromethoxy)phenyl]methylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 3477696) has the molecular formula C23H16F2N4O2 and a molecular weight of 418.40 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3477696 |
| Molecular Formula | C23H16F2N4O2 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methylideneamino]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OC(F)F)cc1)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C23H16F2N4O2/c24-23(25)31-17-9-7-15(8-10-17)13-27-29-22(30)19-12-21(16-4-3-11-26-14-16)28-20-6-2-1-5-18(19)20/h1-14,23H,(H,29,30) |
| InChIKey | OCOCEGMVYNYEJS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|