C24H19F2N3O2 — CID 55385131
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 55385131) has the molecular formula C24H19F2N3O2 and a molecular weight of 419.43 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55385131 |
| Molecular Formula | C24H19F2N3O2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(NCCc1ccc(OC(F)F)cc1)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C24H19F2N3O2/c25-24(26)31-18-9-7-16(8-10-18)11-13-28-23(30)20-14-22(17-4-3-12-27-15-17)29-21-6-2-1-5-19(20)21/h1-10,12,14-15,24H,11,13H2,(H,28,30) |
| InChIKey | HEPRHGKHPDDWAX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |