C21H16N4O — CID 24538422
2-pyridin-3-yl-N-(pyridin-4-ylmethyl)quinoline-4-carboxamide (PubChem CID 24538422) has the molecular formula C21H16N4O and a molecular weight of 340.39 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-(pyridin-4-ylmethyl)quinoline-4-carboxamide.
| Compound Name | 2-pyridin-3-yl-N-(pyridin-4-ylmethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 24538422 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-pyridin-3-yl-N-(pyridin-4-ylmethyl)quinoline-4-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C21H16N4O/c26-21(24-13-15-7-10-22-11-8-15)18-12-20(16-4-3-9-23-14-16)25-19-6-2-1-5-17(18)19/h1-12,14H,13H2,(H,24,26) |
| InChIKey | PSIAPINAOAQBAL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |