C22H15Cl2N3O — CID 50798226
6-chloro-N-[(4-chlorophenyl)methyl]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 50798226) has the molecular formula C22H15Cl2N3O and a molecular weight of 408.29 g/mol. Its IUPAC name is 6-chloro-N-[(4-chlorophenyl)methyl]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | 6-chloro-N-[(4-chlorophenyl)methyl]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 50798226 |
| Molecular Formula | C22H15Cl2N3O |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 6-chloro-N-[(4-chlorophenyl)methyl]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cc(-c2cccnc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H15Cl2N3O/c23-16-5-3-14(4-6-16)12-26-22(28)19-11-21(15-2-1-9-25-13-15)27-20-8-7-17(24)10-18(19)20/h1-11,13H,12H2,(H,26,28) |
| InChIKey | ACXHBWZVWNPYIJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |