C27H19Cl2N5O — CID 71181264
N-[(4-chlorophenyl)methyl]-2-[(7-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide (PubChem CID 71181264) has the molecular formula C27H19Cl2N5O and a molecular weight of 500.39 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(7-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(7-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 71181264 |
| Molecular Formula | C27H19Cl2N5O |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(7-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccccc1Nc1nc(-c2cccnc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C27H19Cl2N5O/c28-19-9-7-17(8-10-19)15-31-27(35)22-5-1-2-6-23(22)32-26-21-12-11-20(29)14-24(21)33-25(34-26)18-4-3-13-30-16-18/h1-14,16H,15H2,(H,31,35)(H,32,33,34) |
| InChIKey | PBTUFRIJRZWJPP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |