C29H24ClN5O2 — CID 135127846
N-[2-(4-chlorophenyl)ethyl]-2-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide (PubChem CID 135127846) has the molecular formula C29H24ClN5O2 and a molecular weight of 510.00 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 135127846 |
| Molecular Formula | C29H24ClN5O2 |
| Molecular Weight | 510.00 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]benzamide |
| SMILES | COc1ccc2nc(-c3cccnc3)nc(Nc3ccccc3C(=O)NCCc3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C29H24ClN5O2/c1-37-22-12-13-26-24(17-22)28(35-27(33-26)20-5-4-15-31-18-20)34-25-7-3-2-6-23(25)29(36)32-16-14-19-8-10-21(30)11-9-19/h2-13,15,17-18H,14,16H2,1H3,(H,32,36)(H,33,34,35) |
| InChIKey | DSGVECFHDWRZNY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.00 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |