C26H18ClN5O — CID 71181011
2-[(6-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]-N-phenylbenzamide (PubChem CID 71181011) has the molecular formula C26H18ClN5O and a molecular weight of 451.92 g/mol. Its IUPAC name is 2-[(6-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]-N-phenylbenzamide.
| Compound Name | 2-[(6-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 71181011 |
| Molecular Formula | C26H18ClN5O |
| Molecular Weight | 451.92 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 2-[(6-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1Nc1nc(-c2cccnc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C26H18ClN5O/c27-18-12-13-23-21(15-18)25(32-24(30-23)17-7-6-14-28-16-17)31-22-11-5-4-10-20(22)26(33)29-19-8-2-1-3-9-19/h1-16H,(H,29,33)(H,30,31,32) |
| InChIKey | FFTCENRXNHNEJP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.92 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |