C26H23Cl3N4 — CID 144500921
6-chloro-N-(2,5-dichloro-4-methylphenyl)-2-pyridin-3-ylquinazolin-4-amine;(2Z,4Z)-hexa-2,4-diene (PubChem CID 144500921) has the molecular formula C26H23Cl3N4 and a molecular weight of 497.86 g/mol. Its IUPAC name is 6-chloro-N-(2,5-dichloro-4-methylphenyl)-2-pyridin-3-ylquinazolin-4-amine;(2Z,4Z)-hexa-2,4-diene.
| Compound Name | 6-chloro-N-(2,5-dichloro-4-methylphenyl)-2-pyridin-3-ylquinazolin-4-amine;(2Z,4Z)-hexa-2,4-diene |
|---|---|
| PubChem CID | 144500921 |
| Molecular Formula | C26H23Cl3N4 |
| Molecular Weight | 497.86 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 6-chloro-N-(2,5-dichloro-4-methylphenyl)-2-pyridin-3-ylquinazolin-4-amine;(2Z,4Z)-hexa-2,4-diene |
| SMILES | C/C=C\C=C/C.Cc1cc(Cl)c(Nc2nc(-c3cccnc3)nc3ccc(Cl)cc23)cc1Cl |
| InChI | InChI=1S/C20H13Cl3N4.C6H10/c1-11-7-16(23)18(9-15(11)22)26-20-14-8-13(21)4-5-17(14)25-19(27-20)12-3-2-6-24-10-12;1-3-5-6-4-2/h2-10H,1H3,(H,25,26,27);3-6H,1-2H3/b;5-3-,6-4- |
| InChIKey | YPRHQCBQGRVGGR-NFAXKJQBSA-N |
| XLogP | 8.84 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.86 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|