C23H21ClN4O2 — CID 144501300
N-(3-chloro-4-methylphenyl)-6-(2-methoxyethoxy)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 144501300) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-6-(2-methoxyethoxy)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-methylphenyl)-6-(2-methoxyethoxy)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 144501300 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-6-(2-methoxyethoxy)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COCCOc1ccc2nc(-c3cccnc3)nc(Nc3ccc(C)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H21ClN4O2/c1-15-5-6-17(12-20(15)24)26-23-19-13-18(30-11-10-29-2)7-8-21(19)27-22(28-23)16-4-3-9-25-14-16/h3-9,12-14H,10-11H2,1-2H3,(H,26,27,28) |
| InChIKey | GNCQOPQPLKETKW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|