C24H22F2N4O4 — CID 71180101
N-[3-(difluoromethoxy)phenyl]-7-methoxy-6-(2-methoxyethoxy)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71180101) has the molecular formula C24H22F2N4O4 and a molecular weight of 468.46 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-7-methoxy-6-(2-methoxyethoxy)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-7-methoxy-6-(2-methoxyethoxy)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71180101 |
| Molecular Formula | C24H22F2N4O4 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-7-methoxy-6-(2-methoxyethoxy)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COCCOc1cc2c(Nc3cccc(OC(F)F)c3)nc(-c3cccnc3)nc2cc1OC |
| InChI | InChI=1S/C24H22F2N4O4/c1-31-9-10-33-21-12-18-19(13-20(21)32-2)29-22(15-5-4-8-27-14-15)30-23(18)28-16-6-3-7-17(11-16)34-24(25)26/h3-8,11-14,24H,9-10H2,1-2H3,(H,28,29,30) |
| InChIKey | LLUASXMGNSXYBN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|