C25H24N6O3 — CID 89271177
2-(3-aminophenyl)-N-(1H-indazol-5-yl)-6-methoxy-7-(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 89271177) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-(1H-indazol-5-yl)-6-methoxy-7-(2-methoxyethoxy)quinazolin-4-amine.
| Compound Name | 2-(3-aminophenyl)-N-(1H-indazol-5-yl)-6-methoxy-7-(2-methoxyethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 89271177 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-(3-aminophenyl)-N-(1H-indazol-5-yl)-6-methoxy-7-(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | COCCOc1cc2nc(-c3cccc(N)c3)nc(Nc3ccc4[nH]ncc4c3)c2cc1OC |
| InChI | InChI=1S/C25H24N6O3/c1-32-8-9-34-23-13-21-19(12-22(23)33-2)25(28-18-6-7-20-16(11-18)14-27-31-20)30-24(29-21)15-4-3-5-17(26)10-15/h3-7,10-14H,8-9,26H2,1-2H3,(H,27,31)(H,28,29,30) |
| InChIKey | LTYGSXSHFBJLJM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|