C18H17N5O2 — CID 58664274
N-(1H-indazol-5-yl)-6,7-dimethoxy-2-methylquinazolin-4-amine (PubChem CID 58664274) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-(1H-indazol-5-yl)-6,7-dimethoxy-2-methylquinazolin-4-amine.
| Compound Name | N-(1H-indazol-5-yl)-6,7-dimethoxy-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 58664274 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(1H-indazol-5-yl)-6,7-dimethoxy-2-methylquinazolin-4-amine |
| SMILES | COc1cc2nc(C)nc(Nc3ccc4[nH]ncc4c3)c2cc1OC |
| InChI | InChI=1S/C18H17N5O2/c1-10-20-15-8-17(25-3)16(24-2)7-13(15)18(21-10)22-12-4-5-14-11(6-12)9-19-23-14/h4-9H,1-3H3,(H,19,23)(H,20,21,22) |
| InChIKey | ZBKLYWKQZQAKCL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |