C20H22N6O2 — CID 141159368
6-[2-(dimethylamino)ethoxy]-N-(1H-indazol-5-yl)-7-methoxyquinazolin-4-amine (PubChem CID 141159368) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethoxy]-N-(1H-indazol-5-yl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-[2-(dimethylamino)ethoxy]-N-(1H-indazol-5-yl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 141159368 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 6-[2-(dimethylamino)ethoxy]-N-(1H-indazol-5-yl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc4[nH]ncc4c3)c2cc1OCCN(C)C |
| InChI | InChI=1S/C20H22N6O2/c1-26(2)6-7-28-19-9-15-17(10-18(19)27-3)21-12-22-20(15)24-14-4-5-16-13(8-14)11-23-25-16/h4-5,8-12H,6-7H2,1-3H3,(H,23,25)(H,21,22,24) |
| InChIKey | FOWZOZJMDJRBLP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |