C24H21ClN4O2 — CID 22030547
N-(1H-indol-5-yl)-6-methoxy-7-phenylmethoxyquinazolin-4-amine;hydrochloride (PubChem CID 22030547) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-6-methoxy-7-phenylmethoxyquinazolin-4-amine;hydrochloride.
| Compound Name | N-(1H-indol-5-yl)-6-methoxy-7-phenylmethoxyquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 22030547 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-(1H-indol-5-yl)-6-methoxy-7-phenylmethoxyquinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2c(Nc3ccc4[nH]ccc4c3)ncnc2cc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C24H20N4O2.ClH/c1-29-22-12-19-21(13-23(22)30-14-16-5-3-2-4-6-16)26-15-27-24(19)28-18-7-8-20-17(11-18)9-10-25-20;/h2-13,15,25H,14H2,1H3,(H,26,27,28);1H |
| InChIKey | BBRDWXSFHWYUSH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |