C17H13IN4O — CID 15521323
N-(1H-indol-5-yl)-6-iodo-7-methoxyquinazolin-4-amine (PubChem CID 15521323) has the molecular formula C17H13IN4O and a molecular weight of 416.22 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-6-iodo-7-methoxyquinazolin-4-amine.
| Compound Name | N-(1H-indol-5-yl)-6-iodo-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 15521323 |
| Molecular Formula | C17H13IN4O |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | N-(1H-indol-5-yl)-6-iodo-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc4[nH]ccc4c3)c2cc1I |
| InChI | InChI=1S/C17H13IN4O/c1-23-16-8-15-12(7-13(16)18)17(21-9-20-15)22-11-2-3-14-10(6-11)4-5-19-14/h2-9,19H,1H3,(H,20,21,22) |
| InChIKey | UWSSPHAKLAHLDF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|