C27H24N4O3 — CID 70245929
6-[2-(3,5-dimethoxyphenyl)ethenyl]-N-(1H-indol-5-yl)-7-methoxyquinazolin-4-amine (PubChem CID 70245929) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is 6-[2-(3,5-dimethoxyphenyl)ethenyl]-N-(1H-indol-5-yl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-[2-(3,5-dimethoxyphenyl)ethenyl]-N-(1H-indol-5-yl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 70245929 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 6-[2-(3,5-dimethoxyphenyl)ethenyl]-N-(1H-indol-5-yl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc(C=Cc2cc3c(Nc4ccc5[nH]ccc5c4)ncnc3cc2OC)cc(OC)c1 |
| InChI | InChI=1S/C27H24N4O3/c1-32-21-10-17(11-22(14-21)33-2)4-5-19-13-23-25(15-26(19)34-3)29-16-30-27(23)31-20-6-7-24-18(12-20)8-9-28-24/h4-16,28H,1-3H3,(H,29,30,31) |
| InChIKey | NTOFZNKWLHFLCH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|