C21H23ClN4O4S — CID 22030654
N-(1H-indol-5-yl)-6-methoxy-7-(3-methylsulfonylpropoxy)quinazolin-4-amine;hydrochloride (PubChem CID 22030654) has the molecular formula C21H23ClN4O4S and a molecular weight of 462.96 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-6-methoxy-7-(3-methylsulfonylpropoxy)quinazolin-4-amine;hydrochloride.
| Compound Name | N-(1H-indol-5-yl)-6-methoxy-7-(3-methylsulfonylpropoxy)quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 22030654 |
| Molecular Formula | C21H23ClN4O4S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-(1H-indol-5-yl)-6-methoxy-7-(3-methylsulfonylpropoxy)quinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2c(Nc3ccc4[nH]ccc4c3)ncnc2cc1OCCCS(C)(=O)=O.Cl |
| InChI | InChI=1S/C21H22N4O4S.ClH/c1-28-19-11-16-18(12-20(19)29-8-3-9-30(2,26)27)23-13-24-21(16)25-15-4-5-17-14(10-15)6-7-22-17;/h4-7,10-13,22H,3,8-9H2,1-2H3,(H,23,24,25);1H |
| InChIKey | NVFGFULNNJDPRG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|