C24H23N5O4S — CID 70206297
4-[3-[4-(1H-indol-6-ylamino)-6-methoxyquinazolin-7-yl]oxypropyl]thiomorpholine-2,3-dione (PubChem CID 70206297) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is 4-[3-[4-(1H-indol-6-ylamino)-6-methoxyquinazolin-7-yl]oxypropyl]thiomorpholine-2,3-dione.
| Compound Name | 4-[3-[4-(1H-indol-6-ylamino)-6-methoxyquinazolin-7-yl]oxypropyl]thiomorpholine-2,3-dione |
|---|---|
| PubChem CID | 70206297 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-[3-[4-(1H-indol-6-ylamino)-6-methoxyquinazolin-7-yl]oxypropyl]thiomorpholine-2,3-dione |
| SMILES | COc1cc2c(Nc3ccc4cc[nH]c4c3)ncnc2cc1OCCCN1CCSC(=O)C1=O |
| InChI | InChI=1S/C24H23N5O4S/c1-32-20-12-17-19(13-21(20)33-9-2-7-29-8-10-34-24(31)23(29)30)26-14-27-22(17)28-16-4-3-15-5-6-25-18(15)11-16/h3-6,11-14,25H,2,7-10H2,1H3,(H,26,27,28) |
| InChIKey | XMXYCODUZYFXAT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|