C23H23N7O2S — CID 22030930
N-(1H-indol-6-yl)-6-methoxy-7-[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propoxy]quinazolin-4-amine (PubChem CID 22030930) has the molecular formula C23H23N7O2S and a molecular weight of 461.55 g/mol. Its IUPAC name is N-(1H-indol-6-yl)-6-methoxy-7-[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propoxy]quinazolin-4-amine.
| Compound Name | N-(1H-indol-6-yl)-6-methoxy-7-[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 22030930 |
| Molecular Formula | C23H23N7O2S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-(1H-indol-6-yl)-6-methoxy-7-[3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propoxy]quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc4cc[nH]c4c3)ncnc2cc1OCCCSc1nncn1C |
| InChI | InChI=1S/C23H23N7O2S/c1-30-14-27-29-23(30)33-9-3-8-32-21-12-19-17(11-20(21)31-2)22(26-13-25-19)28-16-5-4-15-6-7-24-18(15)10-16/h4-7,10-14,24H,3,8-9H2,1-2H3,(H,25,26,28) |
| InChIKey | NNJVTKXDUITXLT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|