C25H24N6O2 — CID 56985158
N-(1H-indol-6-yl)-6-methoxy-7-[2-[(2-methyl-4-pyridinyl)amino]ethoxy]quinazolin-4-amine (PubChem CID 56985158) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is N-(1H-indol-6-yl)-6-methoxy-7-[2-[(2-methyl-4-pyridinyl)amino]ethoxy]quinazolin-4-amine.
| Compound Name | N-(1H-indol-6-yl)-6-methoxy-7-[2-[(2-methyl-4-pyridinyl)amino]ethoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 56985158 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-(1H-indol-6-yl)-6-methoxy-7-[2-[(2-methyl-4-pyridinyl)amino]ethoxy]quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc4cc[nH]c4c3)ncnc2cc1OCCNc1ccnc(C)c1 |
| InChI | InChI=1S/C25H24N6O2/c1-16-11-18(6-8-26-16)27-9-10-33-24-14-22-20(13-23(24)32-2)25(30-15-29-22)31-19-4-3-17-5-7-28-21(17)12-19/h3-8,11-15,28H,9-10H2,1-2H3,(H,26,27)(H,29,30,31) |
| InChIKey | MELJMVRJUNVUQB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|