C23H22ClN3O3 — CID 67698355
6,7-dimethoxy-N-(4-phenylmethoxyphenyl)quinazolin-4-amine;hydrochloride (PubChem CID 67698355) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 6,7-dimethoxy-N-(4-phenylmethoxyphenyl)quinazolin-4-amine;hydrochloride.
| Compound Name | 6,7-dimethoxy-N-(4-phenylmethoxyphenyl)quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 67698355 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 6,7-dimethoxy-N-(4-phenylmethoxyphenyl)quinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4ccccc4)cc3)c2cc1OC.Cl |
| InChI | InChI=1S/C23H21N3O3.ClH/c1-27-21-12-19-20(13-22(21)28-2)24-15-25-23(19)26-17-8-10-18(11-9-17)29-14-16-6-4-3-5-7-16;/h3-13,15H,14H2,1-2H3,(H,24,25,26);1H |
| InChIKey | PXCANWNCXDNVSM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |