C27H32N4O2 — CID 145172275
N-(4-benzylphenyl)-6,7-dimethoxyquinazolin-4-amine;2-methylpropan-1-amine (PubChem CID 145172275) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-(4-benzylphenyl)-6,7-dimethoxyquinazolin-4-amine;2-methylpropan-1-amine.
| Compound Name | N-(4-benzylphenyl)-6,7-dimethoxyquinazolin-4-amine;2-methylpropan-1-amine |
|---|---|
| PubChem CID | 145172275 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-(4-benzylphenyl)-6,7-dimethoxyquinazolin-4-amine;2-methylpropan-1-amine |
| SMILES | CC(C)CN.COc1cc2ncnc(Nc3ccc(Cc4ccccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C23H21N3O2.C4H11N/c1-27-21-13-19-20(14-22(21)28-2)24-15-25-23(19)26-18-10-8-17(9-11-18)12-16-6-4-3-5-7-16;1-4(2)3-5/h3-11,13-15H,12H2,1-2H3,(H,24,25,26);4H,3,5H2,1-2H3 |
| InChIKey | XZKJDMIBWDTUHY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |