C27H31N5O2 — CID 145172257
N'-[[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-phenylmethyl]-N-propylmethanediamine (PubChem CID 145172257) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N'-[[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-phenylmethyl]-N-propylmethanediamine.
| Compound Name | N'-[[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-phenylmethyl]-N-propylmethanediamine |
|---|---|
| PubChem CID | 145172257 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N'-[[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-phenylmethyl]-N-propylmethanediamine |
| SMILES | CCCNCNC(c1ccccc1)c1ccc(Nc2ncnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C27H31N5O2/c1-4-14-28-17-30-26(19-8-6-5-7-9-19)20-10-12-21(13-11-20)32-27-22-15-24(33-2)25(34-3)16-23(22)29-18-31-27/h5-13,15-16,18,26,28,30H,4,14,17H2,1-3H3,(H,29,31,32) |
| InChIKey | WJGSDNUKDOTZEE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|