C24H25N3O2 — CID 145172278
N-[4-[(2S,3E)-3-ethenylhexa-3,5-dien-2-yl]phenyl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 145172278) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[4-[(2S,3E)-3-ethenylhexa-3,5-dien-2-yl]phenyl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-[4-[(2S,3E)-3-ethenylhexa-3,5-dien-2-yl]phenyl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 145172278 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[4-[(2S,3E)-3-ethenylhexa-3,5-dien-2-yl]phenyl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | C=C/C=C(\C=C)[C@H](C)c1ccc(Nc2ncnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-6-8-17(7-2)16(3)18-9-11-19(12-10-18)27-24-20-13-22(28-4)23(29-5)14-21(20)25-15-26-24/h6-16H,1-2H2,3-5H3,(H,25,26,27)/b17-8+/t16-/m0/s1 |
| InChIKey | SIESYLZHBNZFOU-SOWDNDCTSA-N |
| XLogP | 5.79 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|